C15H12N6O2S — CID 155621201
2-N'-(1,3-benzothiazol-2-yl)-4-nitrobenzene-1,2-dicarboximidamide (PubChem CID 155621201) has the molecular formula C15H12N6O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-N'-(1,3-benzothiazol-2-yl)-4-nitrobenzene-1,2-dicarboximidamide.
| Compound Name | 2-N'-(1,3-benzothiazol-2-yl)-4-nitrobenzene-1,2-dicarboximidamide |
|---|---|
| PubChem CID | 155621201 |
| Molecular Formula | C15H12N6O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-N'-(1,3-benzothiazol-2-yl)-4-nitrobenzene-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([N+](=O)[O-])cc1/C(N)=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12N6O2S/c16-13(17)9-6-5-8(21(22)23)7-10(9)14(18)20-15-19-11-3-1-2-4-12(11)24-15/h1-7H,(H3,16,17)(H2,18,19,20) |
| InChIKey | YGJSOICJNPAOCR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|