C15H12N6O3S — CID 171814769
1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(4-nitrophenyl)urea (PubChem CID 171814769) has the molecular formula C15H12N6O3S and a molecular weight of 356.37 g/mol. Its IUPAC name is 1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 171814769 |
| Molecular Formula | C15H12N6O3S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(4-nitrophenyl)urea |
| SMILES | N/C(=N\c1nc2ccccc2s1)NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N6O3S/c16-13(20-15-18-11-3-1-2-4-12(11)25-15)19-14(22)17-9-5-7-10(8-6-9)21(23)24/h1-8H,(H4,16,17,18,19,20,22) |
| InChIKey | VSMLBDDCNLTEFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|