C13H11N5OS — CID 59140291
cis-(1S,2S)-N-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-cyanocyclopropane-1-carboxamide (PubChem CID 59140291) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is cis-(1S,2S)-N-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-cyanocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59140291 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | cis-(1S,2S)-N-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-cyanocyclopropane-1-carboxamide |
| SMILES | N#C[C@H]1C[C@@H]1C(=O)N/C(N)=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H11N5OS/c14-6-7-5-8(7)11(19)17-12(15)18-13-16-9-3-1-2-4-10(9)20-13/h1-4,7-8H,5H2,(H3,15,16,17,18,19)/t7-,8+/m1/s1 |
| InChIKey | FYKQMEIQEOQONQ-SFYZADRCSA-N |
| XLogP | 1.52 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|