C16H15N5OS — CID 172866038
1-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(3-methylphenyl)urea (PubChem CID 172866038) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is 1-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 172866038 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC(N)=Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C16H15N5OS/c1-10-5-4-6-11(9-10)18-15(22)20-14(17)21-16-19-12-7-2-3-8-13(12)23-16/h2-9H,1H3,(H4,17,18,19,20,21,22) |
| InChIKey | ZZUBWVOZOLDHLM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|