C15H14N6OS — CID 155927412
1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 155927412) has the molecular formula C15H14N6OS and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 155927412 |
| Molecular Formula | C15H14N6OS |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[(E)-N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | N/C(=N\c1nc2ccccc2s1)NC(=O)NCc1cccnc1 |
| InChI | InChI=1S/C15H14N6OS/c16-13(20-14(22)18-9-10-4-3-7-17-8-10)21-15-19-11-5-1-2-6-12(11)23-15/h1-8H,9H2,(H4,16,18,19,20,21,22) |
| InChIKey | FPPGENGCSHHQNU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|