C18H15ClN4OS — CID 123384351
trans-(1S,2S)-N-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 123384351) has the molecular formula C18H15ClN4OS and a molecular weight of 370.87 g/mol. Its IUPAC name is trans-(1S,2S)-N-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123384351 |
| Molecular Formula | C18H15ClN4OS |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | trans-(1S,2S)-N-[N'-(1,3-benzothiazol-2-yl)carbamimidoyl]-2-(4-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=Nc1nc2ccccc2s1)NC(=O)[C@H]1C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN4OS/c19-11-7-5-10(6-8-11)12-9-13(12)16(24)22-17(20)23-18-21-14-3-1-2-4-15(14)25-18/h1-8,12-13H,9H2,(H3,20,21,22,23,24)/t12-,13+/m1/s1 |
| InChIKey | DRXSZBRMNTVZIN-OLZOCXBDSA-N |
| XLogP | 3.82 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|