C19H20N6O2S — CID 170920970
1,3-benzothiazol-2-yl-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methyl]diazene (PubChem CID 170920970) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methyl]diazene.
| Compound Name | 1,3-benzothiazol-2-yl-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methyl]diazene |
|---|---|
| PubChem CID | 170920970 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1,3-benzothiazol-2-yl-[[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]methyl]diazene |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2C/N=N/c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C19H20N6O2S/c1-23-8-10-24(11-9-23)17-7-6-15(25(26)27)12-14(17)13-20-22-19-21-16-4-2-3-5-18(16)28-19/h2-7,12H,8-11,13H2,1H3/b22-20+ |
| InChIKey | SFURIFDTMCTTET-LSDHQDQOSA-N |
| XLogP | 4.24 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|