About CID 155627629
CID 155627629 (PubChem CID 155627629) has the molecular formula C43H53InN5O5
and a molecular weight of 834.74 g/mol.
Molecular Properties
| Compound Name | CID 155627629 |
| PubChem CID | 155627629 |
| Molecular Formula | C43H53InN5O5 |
| Molecular Weight | 834.74 g/mol |
| Exact Mass | 834.31 |
| IUPAC Name | — |
| SMILES | C=Cc1c(C)/c2n3/c1=C\C1=N/C(=C\c4c(C)c(C(=O)NCCCCCCC)c(n4[In]3)/C(CC(=O)OC)=C3\N=C(/C=2)[C@@H](C)[C@@H]3CCCOC=O)C(CC)=C1C |
| InChI | InChI=1S/C43H54N5O5.In/c1-9-12-13-14-15-18-44-43(51)40-28(7)36-23-38-30(11-3)26(5)34(46-38)22-37-29(10-2)25(4)33(45-37)21-35-27(6)31(17-16-19-53-24-49)41(47-35)32(42(40)48-36)20-39(50)52-8;/h10,21-24,27,31H,2,9,11-20H2,1,3-8H3,(H2-,44,45,46,47,48,51);/q-1;+2/p-1/t27-,31-;/m0./s1 |
| InChIKey | QJENPNRQVXTKEY-BKCZFPKYSA-M |
| XLogP | 6.22 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 834.74 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 155627629 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155627629?
The IUPAC name of CID 155627629 (CID 155627629) is not available.
What is the SMILES notation for CID 155627629?
The canonical SMILES for CID 155627629 is C=Cc1c(C)/c2n3/c1=C\C1=N/C(=C\c4c(C)c(C(=O)NCCCCCCC)c(n4[In]3)/C(CC(=O)OC)=C3\N=C(/C=2)[C@@H](C)[C@@H]3CCCOC=O)C(CC)=C1C.
What is the InChIKey of CID 155627629?
The InChIKey is QJENPNRQVXTKEY-BKCZFPKYSA-M. The full InChI is InChI=1S/C43H54N5O5.In/c1-9-12-13-14-15-18-44-43(51)40-28(7)36-23-38-30(11-3)26(5)34(46-38)22-37-29(10-2)25(4)33(45-37)21-35-27(6)31(17-16-19-53-24-49)41(47-35)32(42(40)48-36)20-39(50)52-8;/h10,21-24,27,31H,2,9,11-20H2,1,3-8H3,(H2-,44,45,46,47,48,51);/q-1;+2/p-1/t27-,31-;/m0./s1.
What are the key properties of CID 155627629?
CID 155627629 has a molecular weight of 834.74 g/mol, XLogP of 6.22, 16 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155627629 is sourced from PubChem (CID 155627629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).