C22H19NO — CID 155628870
6-phenyl-2-(2,4,6-trimethylphenyl)furo[2,3-b]pyridine (PubChem CID 155628870) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is 6-phenyl-2-(2,4,6-trimethylphenyl)furo[2,3-b]pyridine.
| Compound Name | 6-phenyl-2-(2,4,6-trimethylphenyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 155628870 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-phenyl-2-(2,4,6-trimethylphenyl)furo[2,3-b]pyridine |
| SMILES | Cc1cc(C)c(-c2cc3ccc(-c4ccccc4)nc3o2)c(C)c1 |
| InChI | InChI=1S/C22H19NO/c1-14-11-15(2)21(16(3)12-14)20-13-18-9-10-19(23-22(18)24-20)17-7-5-4-6-8-17/h4-13H,1-3H3 |
| InChIKey | QKEWFIUUMMSZIY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |