C16H22Cl2N2O — CID 155630784
N-[[2,3-dichloro-2-(dimethylamino)cyclohexyl]methyl]benzamide (PubChem CID 155630784) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is N-[[2,3-dichloro-2-(dimethylamino)cyclohexyl]methyl]benzamide.
| Compound Name | N-[[2,3-dichloro-2-(dimethylamino)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 155630784 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[[2,3-dichloro-2-(dimethylamino)cyclohexyl]methyl]benzamide |
| SMILES | CN(C)C1(Cl)C(Cl)CCCC1CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-20(2)16(18)13(9-6-10-14(16)17)11-19-15(21)12-7-4-3-5-8-12/h3-5,7-8,13-14H,6,9-11H2,1-2H3,(H,19,21) |
| InChIKey | GZTKQXDELDDDRT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|