C28H44ClNO3 — CID 155631162
[2-(2-chlorocyclohexyl)-9-tricyclo[9.4.0.03,8]pentadecanyl]-(4-nitrocyclohexyl)methanone (PubChem CID 155631162) has the molecular formula C28H44ClNO3 and a molecular weight of 478.12 g/mol. Its IUPAC name is [2-(2-chlorocyclohexyl)-9-tricyclo[9.4.0.03,8]pentadecanyl]-(4-nitrocyclohexyl)methanone.
| Compound Name | [2-(2-chlorocyclohexyl)-9-tricyclo[9.4.0.03,8]pentadecanyl]-(4-nitrocyclohexyl)methanone |
|---|---|
| PubChem CID | 155631162 |
| Molecular Formula | C28H44ClNO3 |
| Molecular Weight | 478.12 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | [2-(2-chlorocyclohexyl)-9-tricyclo[9.4.0.03,8]pentadecanyl]-(4-nitrocyclohexyl)methanone |
| SMILES | O=C(C1CCC([N+](=O)[O-])CC1)C1CC2CCCCC2C(C2CCCCC2Cl)C2CCCCC12 |
| InChI | InChI=1S/C28H44ClNO3/c29-26-12-6-5-11-24(26)27-21-8-2-1-7-19(21)17-25(22-9-3-4-10-23(22)27)28(31)18-13-15-20(16-14-18)30(32)33/h18-27H,1-17H2 |
| InChIKey | XWQOUGAVYWXKDR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.12 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|