C36H54N4+2 — CID 155634766
[4-[4-[bis(2-methylpropyl)amino]-N-methylanilino]phenyl]-[4-[bis(2-methylpropyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium (PubChem CID 155634766) has the molecular formula C36H54N4+2 and a molecular weight of 542.86 g/mol. Its IUPAC name is [4-[4-[bis(2-methylpropyl)amino]-N-methylanilino]phenyl]-[4-[bis(2-methylpropyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium.
| Compound Name | [4-[4-[bis(2-methylpropyl)amino]-N-methylanilino]phenyl]-[4-[bis(2-methylpropyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium |
|---|---|
| PubChem CID | 155634766 |
| Molecular Formula | C36H54N4+2 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.43 |
| IUPAC Name | [4-[4-[bis(2-methylpropyl)amino]-N-methylanilino]phenyl]-[4-[bis(2-methylpropyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium |
| SMILES | CC(C)CN(CC(C)C)c1ccc(N(C)c2ccc([N+](C)=C3C=CC(=[N+](CC(C)C)CC(C)C)C=C3)cc2)cc1 |
| InChI | InChI=1S/C36H54N4/c1-27(2)23-39(24-28(3)4)35-19-15-33(16-20-35)37(9)31-11-13-32(14-12-31)38(10)34-17-21-36(22-18-34)40(25-29(5)6)26-30(7)8/h11-22,27-30H,23-26H2,1-10H3/q+2 |
| InChIKey | HVJLQGCXGHGHFY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|