C32H38N4+2 — CID 155634777
[4-[4-[bis(prop-2-enyl)amino]-N-methylanilino]phenyl]-[4-bis(prop-2-enyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-methylazanium (PubChem CID 155634777) has the molecular formula C32H38N4+2 and a molecular weight of 478.68 g/mol. Its IUPAC name is [4-[4-[bis(prop-2-enyl)amino]-N-methylanilino]phenyl]-[4-bis(prop-2-enyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-methylazanium.
| Compound Name | [4-[4-[bis(prop-2-enyl)amino]-N-methylanilino]phenyl]-[4-bis(prop-2-enyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-methylazanium |
|---|---|
| PubChem CID | 155634777 |
| Molecular Formula | C32H38N4+2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | [4-[4-[bis(prop-2-enyl)amino]-N-methylanilino]phenyl]-[4-bis(prop-2-enyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]-methylazanium |
| SMILES | C=CCN(CC=C)c1ccc(N(C)c2ccc([N+](C)=C3C=CC(=[N+](CC=C)CC=C)C=C3)cc2)cc1 |
| InChI | InChI=1S/C32H38N4/c1-7-23-35(24-8-2)31-19-15-29(16-20-31)33(5)27-11-13-28(14-12-27)34(6)30-17-21-32(22-18-30)36(25-9-3)26-10-4/h7-22H,1-4,23-26H2,5-6H3/q+2 |
| InChIKey | RCWGKGNLSNLWLU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|