C41H30N4Pt — CID 155636205
2-[[3-(3,5-dimethylpyrazol-1-yl)benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) (PubChem CID 155636205) has the molecular formula C41H30N4Pt and a molecular weight of 773.80 g/mol. Its IUPAC name is 2-[[3-(3,5-dimethylpyrazol-1-yl)benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-[[3-(3,5-dimethylpyrazol-1-yl)benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 155636205 |
| Molecular Formula | C41H30N4Pt |
| Molecular Weight | 773.80 g/mol |
| Exact Mass | 773.21 |
| IUPAC Name | 2-[[3-(3,5-dimethylpyrazol-1-yl)benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1cc(C)n(-c2[c-]c(C(c3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)(c3ccccc3)c3ccccc3)ccc2)n1.[Pt+2] |
| InChI | InChI=1S/C41H30N4.Pt/c1-29-26-30(2)45(43-29)35-19-13-18-33(27-35)41(31-14-5-3-6-15-31,32-16-7-4-8-17-32)34-23-24-37-36-20-9-10-21-38(36)44(39(37)28-34)40-22-11-12-25-42-40;/h3-26H,1-2H3;/q-2;+2 |
| InChIKey | ZTGMYJYIQPXEIZ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.80 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|