C48H33N5Pt — CID 155635849
7-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-8H-carbazol-8-ide-2-carbonitrile;platinum(2+) (PubChem CID 155635849) has the molecular formula C48H33N5Pt and a molecular weight of 874.91 g/mol. Its IUPAC name is 7-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-8H-carbazol-8-ide-2-carbonitrile;platinum(2+).
| Compound Name | 7-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-8H-carbazol-8-ide-2-carbonitrile;platinum(2+) |
|---|---|
| PubChem CID | 155635849 |
| Molecular Formula | C48H33N5Pt |
| Molecular Weight | 874.91 g/mol |
| Exact Mass | 874.24 |
| IUPAC Name | 7-[[3-[1-(2,6-dimethylphenyl)imidazol-4-yl]benzene-2-id-1-yl]-diphenylmethyl]-9-pyridin-2-yl-8H-carbazol-8-ide-2-carbonitrile;platinum(2+) |
| SMILES | Cc1cccc(C)c1-n1cnc(-c2[c-]c(C(c3[c-]c4c(cc3)c3ccc(C#N)cc3n4-c3ccccn3)(c3ccccc3)c3ccccc3)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C48H33N5.Pt/c1-33-13-11-14-34(2)47(33)52-31-43(51-32-52)36-15-12-20-39(28-36)48(37-16-5-3-6-17-37,38-18-7-4-8-19-38)40-23-25-42-41-24-22-35(30-49)27-44(41)53(45(42)29-40)46-21-9-10-26-50-46;/h3-27,31-32H,1-2H3;/q-2;+2 |
| InChIKey | NIFSRXVYRKAPNO-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.91 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|