C35H25N5O — CID 167415079
7-[3-[3-(2,6-dimethylphenyl)-2H-imidazol-1-ium-2-id-1-yl]phenoxy]-9-pyridin-2-ylcarbazole-3-carbonitrile (PubChem CID 167415079) has the molecular formula C35H25N5O and a molecular weight of 531.62 g/mol. Its IUPAC name is 7-[3-[3-(2,6-dimethylphenyl)-2H-imidazol-1-ium-2-id-1-yl]phenoxy]-9-pyridin-2-ylcarbazole-3-carbonitrile.
| Compound Name | 7-[3-[3-(2,6-dimethylphenyl)-2H-imidazol-1-ium-2-id-1-yl]phenoxy]-9-pyridin-2-ylcarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 167415079 |
| Molecular Formula | C35H25N5O |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 7-[3-[3-(2,6-dimethylphenyl)-2H-imidazol-1-ium-2-id-1-yl]phenoxy]-9-pyridin-2-ylcarbazole-3-carbonitrile |
| SMILES | Cc1cccc(C)c1-n1[c-][n+](-c2cccc(Oc3ccc4c5cc(C#N)ccc5n(-c5ccccn5)c4c3)c2)cc1 |
| InChI | InChI=1S/C35H25N5O/c1-24-7-5-8-25(2)35(24)39-18-17-38(23-39)27-9-6-10-28(20-27)41-29-13-14-30-31-19-26(22-36)12-15-32(31)40(33(30)21-29)34-11-3-4-16-37-34/h3-21H,1-2H3 |
| InChIKey | UVKCGZOEXIUVKG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 59.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|