C14H15BCl2N2O4 — CID 155637480
[3,5-dichloro-4-(6-methoxy-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid (PubChem CID 155637480) has the molecular formula C14H15BCl2N2O4 and a molecular weight of 357.00 g/mol. Its IUPAC name is [3,5-dichloro-4-(6-methoxy-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid.
| Compound Name | [3,5-dichloro-4-(6-methoxy-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid |
|---|---|
| PubChem CID | 155637480 |
| Molecular Formula | C14H15BCl2N2O4 |
| Molecular Weight | 357.00 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [3,5-dichloro-4-(6-methoxy-5-propan-2-ylpyridazin-3-yl)oxyphenyl]boronic acid |
| SMILES | COc1nnc(Oc2c(Cl)cc(B(O)O)cc2Cl)cc1C(C)C |
| InChI | InChI=1S/C14H15BCl2N2O4/c1-7(2)9-6-12(18-19-14(9)22-3)23-13-10(16)4-8(15(20)21)5-11(13)17/h4-7,20-21H,1-3H3 |
| InChIKey | XMQBMGZYQVLEDT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.00 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|