C17H22BN3O5S — CID 155639882
N-[6-pyridin-3-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanesulfonamide (PubChem CID 155639882) has the molecular formula C17H22BN3O5S and a molecular weight of 391.26 g/mol. Its IUPAC name is N-[6-pyridin-3-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[6-pyridin-3-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 155639882 |
| Molecular Formula | C17H22BN3O5S |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-[6-pyridin-3-yloxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methanesulfonamide |
| SMILES | CC1(C)OB(c2cc(NS(C)(=O)=O)cnc2Oc2cccnc2)OC1(C)C |
| InChI | InChI=1S/C17H22BN3O5S/c1-16(2)17(3,4)26-18(25-16)14-9-12(21-27(5,22)23)10-20-15(14)24-13-7-6-8-19-11-13/h6-11,21H,1-5H3 |
| InChIKey | MPUJRMXCSALUBJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|