C16H22N4O5S — CID 15564364
2-[2-hydroxy-3-(N-phenylanilino)propyl]guanidine;sulfuric acid (PubChem CID 15564364) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(N-phenylanilino)propyl]guanidine;sulfuric acid.
| Compound Name | 2-[2-hydroxy-3-(N-phenylanilino)propyl]guanidine;sulfuric acid |
|---|---|
| PubChem CID | 15564364 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[2-hydroxy-3-(N-phenylanilino)propyl]guanidine;sulfuric acid |
| SMILES | NC(N)=NCC(O)CN(c1ccccc1)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C16H20N4O.H2O4S/c17-16(18)19-11-15(21)12-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-5(2,3)4/h1-10,15,21H,11-12H2,(H4,17,18,19);(H2,1,2,3,4) |
| InChIKey | KQDGUDPMUPUGLL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 162.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|