C10H18N2O6S — CID 70151097
1-amino-2-[4-(2-amino-2-hydroxyethyl)phenyl]ethanol;sulfuric acid (PubChem CID 70151097) has the molecular formula C10H18N2O6S and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-amino-2-[4-(2-amino-2-hydroxyethyl)phenyl]ethanol;sulfuric acid.
| Compound Name | 1-amino-2-[4-(2-amino-2-hydroxyethyl)phenyl]ethanol;sulfuric acid |
|---|---|
| PubChem CID | 70151097 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-amino-2-[4-(2-amino-2-hydroxyethyl)phenyl]ethanol;sulfuric acid |
| SMILES | NC(O)Cc1ccc(CC(N)O)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C10H16N2O2.H2O4S/c11-9(13)5-7-1-2-8(4-3-7)6-10(12)14;1-5(2,3)4/h1-4,9-10,13-14H,5-6,11-12H2;(H2,1,2,3,4) |
| InChIKey | FLCJWYRZSMADIH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|