C24H39NO3 — CID 155645513
2-[2-(4-tert-butylphenyl)propyl]-2-methyl-4-(propan-2-ylcarbamoyl)hexanoic acid (PubChem CID 155645513) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)propyl]-2-methyl-4-(propan-2-ylcarbamoyl)hexanoic acid.
| Compound Name | 2-[2-(4-tert-butylphenyl)propyl]-2-methyl-4-(propan-2-ylcarbamoyl)hexanoic acid |
|---|---|
| PubChem CID | 155645513 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)propyl]-2-methyl-4-(propan-2-ylcarbamoyl)hexanoic acid |
| SMILES | CCC(CC(C)(CC(C)c1ccc(C(C)(C)C)cc1)C(=O)O)C(=O)NC(C)C |
| InChI | InChI=1S/C24H39NO3/c1-9-18(21(26)25-16(2)3)15-24(8,22(27)28)14-17(4)19-10-12-20(13-11-19)23(5,6)7/h10-13,16-18H,9,14-15H2,1-8H3,(H,25,26)(H,27,28) |
| InChIKey | OOXJIQILJBSFGK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |