C35H56N2O — CID 170687350
2-[2-(4-butan-2-ylphenyl)propyl]-4-(4-tert-butylphenyl)-N-[3-(dimethylamino)propyl]-2-methylhexanamide (PubChem CID 170687350) has the molecular formula C35H56N2O and a molecular weight of 520.85 g/mol. Its IUPAC name is 2-[2-(4-butan-2-ylphenyl)propyl]-4-(4-tert-butylphenyl)-N-[3-(dimethylamino)propyl]-2-methylhexanamide.
| Compound Name | 2-[2-(4-butan-2-ylphenyl)propyl]-4-(4-tert-butylphenyl)-N-[3-(dimethylamino)propyl]-2-methylhexanamide |
|---|---|
| PubChem CID | 170687350 |
| Molecular Formula | C35H56N2O |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.44 |
| IUPAC Name | 2-[2-(4-butan-2-ylphenyl)propyl]-4-(4-tert-butylphenyl)-N-[3-(dimethylamino)propyl]-2-methylhexanamide |
| SMILES | CCC(C)c1ccc(C(C)CC(C)(CC(CC)c2ccc(C(C)(C)C)cc2)C(=O)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C35H56N2O/c1-11-26(3)29-14-16-30(17-15-29)27(4)24-35(8,33(38)36-22-13-23-37(9)10)25-28(12-2)31-18-20-32(21-19-31)34(5,6)7/h14-21,26-28H,11-13,22-25H2,1-10H3,(H,36,38) |
| InChIKey | AUHWOEHSYUNZFA-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|