C7H11Cl2OP — CID 15564773
(1R,2S,4S)-2-dichlorophosphorylbicyclo[2.2.1]heptane (PubChem CID 15564773) has the molecular formula C7H11Cl2OP and a molecular weight of 213.04 g/mol. Its IUPAC name is (1R,2S,4S)-2-dichlorophosphorylbicyclo[2.2.1]heptane.
| Compound Name | (1R,2S,4S)-2-dichlorophosphorylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 15564773 |
| Molecular Formula | C7H11Cl2OP |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | (1R,2S,4S)-2-dichlorophosphorylbicyclo[2.2.1]heptane |
| SMILES | O=P(Cl)(Cl)[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C7H11Cl2OP/c8-11(9,10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7-/m0/s1 |
| InChIKey | VBVRJIIWKDCPCX-XVMARJQXSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|