C17H29ClSi — CID 155648111
chloro-(2,3-dimethylbutan-2-yl)-ethyl-(2-phenylpropan-2-yl)silane (PubChem CID 155648111) has the molecular formula C17H29ClSi and a molecular weight of 296.96 g/mol. Its IUPAC name is chloro-(2,3-dimethylbutan-2-yl)-ethyl-(2-phenylpropan-2-yl)silane.
| Compound Name | chloro-(2,3-dimethylbutan-2-yl)-ethyl-(2-phenylpropan-2-yl)silane |
|---|---|
| PubChem CID | 155648111 |
| Molecular Formula | C17H29ClSi |
| Molecular Weight | 296.96 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | chloro-(2,3-dimethylbutan-2-yl)-ethyl-(2-phenylpropan-2-yl)silane |
| SMILES | CC[Si](Cl)(C(C)(C)c1ccccc1)C(C)(C)C(C)C |
| InChI | InChI=1S/C17H29ClSi/c1-8-19(18,16(4,5)14(2)3)17(6,7)15-12-10-9-11-13-15/h9-14H,8H2,1-7H3 |
| InChIKey | FUKSDPBUQDLXQC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.96 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|