C36H54Cl2Si3 — CID 100919461
bis[chloro-(2,3-dimethylbutan-2-yl)-phenylsilyl]-(2,3-dimethylbutan-2-yl)-phenylsilane (PubChem CID 100919461) has the molecular formula C36H54Cl2Si3 and a molecular weight of 641.99 g/mol. Its IUPAC name is bis[chloro-(2,3-dimethylbutan-2-yl)-phenylsilyl]-(2,3-dimethylbutan-2-yl)-phenylsilane.
| Compound Name | bis[chloro-(2,3-dimethylbutan-2-yl)-phenylsilyl]-(2,3-dimethylbutan-2-yl)-phenylsilane |
|---|---|
| PubChem CID | 100919461 |
| Molecular Formula | C36H54Cl2Si3 |
| Molecular Weight | 641.99 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | bis[chloro-(2,3-dimethylbutan-2-yl)-phenylsilyl]-(2,3-dimethylbutan-2-yl)-phenylsilane |
| SMILES | CC(C)C(C)(C)[Si](c1ccccc1)([Si@](Cl)(c1ccccc1)C(C)(C)C(C)C)[Si@](Cl)(c1ccccc1)C(C)(C)C(C)C |
| InChI | InChI=1S/C36H54Cl2Si3/c1-28(2)34(7,8)39(37,31-22-16-13-17-23-31)41(36(11,12)30(5)6,33-26-20-15-21-27-33)40(38,35(9,10)29(3)4)32-24-18-14-19-25-32/h13-30H,1-12H3/t39-,40-/m1/s1 |
| InChIKey | BQPCCUXDEORPRE-XRSDMRJBSA-N |
| XLogP | 9.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.99 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|