C19H31BN3O5PS — CID 155648260
CID 155648260 (PubChem CID 155648260) has the molecular formula C19H31BN3O5PS and a molecular weight of 456.33 g/mol.
| Compound Name | CID 155648260 |
|---|---|
| PubChem CID | 155648260 |
| Molecular Formula | C19H31BN3O5PS |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | — |
| SMILES | [2H]P([B])C(=O)C(C)NC(=O)[C@@H](NC(=O)CCCCCN1C(=O)CC(SC)C1=O)C(C)C |
| InChI | InChI=1S/C19H31BN3O5PS/c1-11(2)16(17(26)21-12(3)19(28)29-20)22-14(24)8-6-5-7-9-23-15(25)10-13(30-4)18(23)27/h11-13,16,29H,5-10H2,1-4H3,(H,21,26)(H,22,24)/t12?,13?,16-,29?/m0/s1/i29D |
| InChIKey | LFAYZSPADSFYBW-QQNUWVIJSA-N |
| XLogP | 0.97 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|