C11H15F2O4- — CID 155650708
2,2-difluoro-5-(1-methylcyclopentyl)oxy-5-oxopentanoate (PubChem CID 155650708) has the molecular formula C11H15F2O4- and a molecular weight of 249.23 g/mol. Its IUPAC name is 2,2-difluoro-5-(1-methylcyclopentyl)oxy-5-oxopentanoate.
| Compound Name | 2,2-difluoro-5-(1-methylcyclopentyl)oxy-5-oxopentanoate |
|---|---|
| PubChem CID | 155650708 |
| Molecular Formula | C11H15F2O4- |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2,2-difluoro-5-(1-methylcyclopentyl)oxy-5-oxopentanoate |
| SMILES | CC1(OC(=O)CCC(F)(F)C(=O)[O-])CCCC1 |
| InChI | InChI=1S/C11H16F2O4/c1-10(5-2-3-6-10)17-8(14)4-7-11(12,13)9(15)16/h2-7H2,1H3,(H,15,16)/p-1 |
| InChIKey | VYYBIRUYEZZNDD-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |