About (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate
(1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate (PubChem CID 162555204) has the molecular formula C12H18F3IO2
and a molecular weight of 378.17 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate.
Molecular Properties
| Compound Name | (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate |
| PubChem CID | 162555204 |
| Molecular Formula | C12H18F3IO2 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate |
| SMILES | CCCC(I)(C(=O)OC1(C)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H18F3IO2/c1-3-6-11(16,12(13,14)15)9(17)18-10(2)7-4-5-8-10/h3-8H2,1-2H3 |
| InChIKey | IHOPHSFMIBBXDY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate?
The IUPAC name of (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate (CID 162555204) is (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate.
What is the SMILES notation for (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate?
The canonical SMILES for (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate is CCCC(I)(C(=O)OC1(C)CCCC1)C(F)(F)F.
What is the InChIKey of (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate?
The InChIKey is IHOPHSFMIBBXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3IO2/c1-3-6-11(16,12(13,14)15)9(17)18-10(2)7-4-5-8-10/h3-8H2,1-2H3.
What are the key properties of (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate?
(1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate has a molecular weight of 378.17 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopentyl) 2-iodo-2-(trifluoromethyl)pentanoate is sourced from PubChem (CID 162555204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).