C60H45NSi2 — CID 155655782
N-[4-[4-[cyclohexa-1,5-dien-3-yn-1-yl(diphenyl)silyl]phenyl]phenyl]-4-(4-triphenylsilylphenyl)aniline (PubChem CID 155655782) has the molecular formula C60H45NSi2 and a molecular weight of 836.20 g/mol. Its IUPAC name is N-[4-[4-[cyclohexa-1,5-dien-3-yn-1-yl(diphenyl)silyl]phenyl]phenyl]-4-(4-triphenylsilylphenyl)aniline.
| Compound Name | N-[4-[4-[cyclohexa-1,5-dien-3-yn-1-yl(diphenyl)silyl]phenyl]phenyl]-4-(4-triphenylsilylphenyl)aniline |
|---|---|
| PubChem CID | 155655782 |
| Molecular Formula | C60H45NSi2 |
| Molecular Weight | 836.20 g/mol |
| Exact Mass | 835.31 |
| IUPAC Name | N-[4-[4-[cyclohexa-1,5-dien-3-yn-1-yl(diphenyl)silyl]phenyl]phenyl]-4-(4-triphenylsilylphenyl)aniline |
| SMILES | c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc(-c3ccc(Nc4ccc(-c5ccc([Si](c6ccccc6)(c6ccccc6)c6ccccc6)cc5)cc4)cc3)cc2)cc#1 |
| InChI | InChI=1S/C60H45NSi2/c1-7-19-53(20-8-1)62(54-21-9-2-10-22-54,55-23-11-3-12-24-55)59-43-35-49(36-44-59)47-31-39-51(40-32-47)61-52-41-33-48(34-42-52)50-37-45-60(46-38-50)63(56-25-13-4-14-26-56,57-27-15-5-16-28-57)58-29-17-6-18-30-58/h1-5,7-17,19-46,61H |
| InChIKey | NQFIMMFIIZAQAO-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.20 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|