C54H31N5S — CID 155656610
3-[2-([1]benzothiolo[3,2-c]carbazol-5-yl)-5-(2,6-diphenylpyrimidin-4-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile (PubChem CID 155656610) has the molecular formula C54H31N5S and a molecular weight of 781.94 g/mol. Its IUPAC name is 3-[2-([1]benzothiolo[3,2-c]carbazol-5-yl)-5-(2,6-diphenylpyrimidin-4-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile.
| Compound Name | 3-[2-([1]benzothiolo[3,2-c]carbazol-5-yl)-5-(2,6-diphenylpyrimidin-4-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155656610 |
| Molecular Formula | C54H31N5S |
| Molecular Weight | 781.94 g/mol |
| Exact Mass | 781.23 |
| IUPAC Name | 3-[2-([1]benzothiolo[3,2-c]carbazol-5-yl)-5-(2,6-diphenylpyrimidin-4-yl)-3-(3-isocyanophenyl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cccc(C#N)c3)c2-n2c3ccccc3c3c4sc5ccccc5c4ccc32)c1 |
| InChI | InChI=1S/C54H31N5S/c1-56-40-21-13-20-38(29-40)45-31-39(47-32-46(35-15-4-2-5-16-35)57-54(58-47)36-17-6-3-7-18-36)30-44(37-19-12-14-34(28-37)33-55)52(45)59-48-24-10-8-23-43(48)51-49(59)27-26-42-41-22-9-11-25-50(41)60-53(42)51/h2-32H |
| InChIKey | QLLIJRAHCZQTTC-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.94 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|