About 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea
3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea (PubChem CID 155658477) has the molecular formula C13H13Cl2N3O3
and a molecular weight of 330.17 g/mol. Its IUPAC name is 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea.
Molecular Properties
| Compound Name | 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea |
| PubChem CID | 155658477 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea |
| SMILES | NC(=O)Nc1cc(O)ccc1Cl.Nc1cc(O)ccc1Cl |
| InChI | InChI=1S/C7H7ClN2O2.C6H6ClNO/c8-5-2-1-4(11)3-6(5)10-7(9)12;7-5-2-1-4(9)3-6(5)8/h1-3,11H,(H3,9,10,12);1-3,9H,8H2 |
| InChIKey | AUAYNIZMZCHEDH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea?
The IUPAC name of 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea (CID 155658477) is 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea.
What is the SMILES notation for 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea?
The canonical SMILES for 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea is NC(=O)Nc1cc(O)ccc1Cl.Nc1cc(O)ccc1Cl.
What is the InChIKey of 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea?
The InChIKey is AUAYNIZMZCHEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O2.C6H6ClNO/c8-5-2-1-4(11)3-6(5)10-7(9)12;7-5-2-1-4(9)3-6(5)8/h1-3,11H,(H3,9,10,12);1-3,9H,8H2.
What are the key properties of 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea?
3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea has a molecular weight of 330.17 g/mol, XLogP of 3.16, 1 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-chlorophenol;(2-chloro-5-hydroxyphenyl)urea is sourced from PubChem (CID 155658477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).