C40H32F6O11S2 — CID 155658652
methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[2-[4-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenoxy]acetyl]oxybenzoate (PubChem CID 155658652) has the molecular formula C40H32F6O11S2 and a molecular weight of 866.81 g/mol. Its IUPAC name is methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[2-[4-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenoxy]acetyl]oxybenzoate.
| Compound Name | methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[2-[4-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenoxy]acetyl]oxybenzoate |
|---|---|
| PubChem CID | 155658652 |
| Molecular Formula | C40H32F6O11S2 |
| Molecular Weight | 866.81 g/mol |
| Exact Mass | 866.13 |
| IUPAC Name | methyl 3-ethyl-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]-2-[2-[4-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]phenoxy]acetyl]oxybenzoate |
| SMILES | CCc1c(CCc2cccc3c2C(OS(=O)(=O)C(F)(F)F)=CC3)ccc(C(=O)OC)c1OC(=O)COc1ccc(-c2cccc3c2C(OS(=O)(=O)C(F)(F)F)=CC3)cc1 |
| InChI | InChI=1S/C40H32F6O11S2/c1-3-29-23(10-11-25-6-4-7-26-15-20-32(35(25)26)56-58(49,50)39(41,42)43)14-19-31(38(48)53-2)37(29)55-34(47)22-54-28-17-12-24(13-18-28)30-9-5-8-27-16-21-33(36(27)30)57-59(51,52)40(44,45)46/h4-9,12-14,17-21H,3,10-11,15-16,22H2,1-2H3 |
| InChIKey | ZMJXICGWIGAGLJ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.81 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|