C34H33NO4 — CID 155662747
ethyl (1E,3E)-3-[(1-benzylindol-3-yl)-hydroxymethylidene]-2-(4-methylphenyl)-4-oxocyclooctene-1-carboxylate (PubChem CID 155662747) has the molecular formula C34H33NO4 and a molecular weight of 519.64 g/mol. Its IUPAC name is ethyl (1E,3E)-3-[(1-benzylindol-3-yl)-hydroxymethylidene]-2-(4-methylphenyl)-4-oxocyclooctene-1-carboxylate.
| Compound Name | ethyl (1E,3E)-3-[(1-benzylindol-3-yl)-hydroxymethylidene]-2-(4-methylphenyl)-4-oxocyclooctene-1-carboxylate |
|---|---|
| PubChem CID | 155662747 |
| Molecular Formula | C34H33NO4 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | ethyl (1E,3E)-3-[(1-benzylindol-3-yl)-hydroxymethylidene]-2-(4-methylphenyl)-4-oxocyclooctene-1-carboxylate |
| SMILES | CCOC(=O)/C1=C(c2ccc(C)cc2)/C(=C(\O)c2cn(Cc3ccccc3)c3ccccc23)C(=O)CCCC1 |
| InChI | InChI=1S/C34H33NO4/c1-3-39-34(38)27-14-8-10-16-30(36)32(31(27)25-19-17-23(2)18-20-25)33(37)28-22-35(21-24-11-5-4-6-12-24)29-15-9-7-13-26(28)29/h4-7,9,11-13,15,17-20,22,37H,3,8,10,14,16,21H2,1-2H3/b31-27+,33-32- |
| InChIKey | YDGRCEORVUEKCZ-FYGKBJFBSA-N |
| XLogP | 7.43 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|