C21H26N6O4S — CID 155663157
N-(2-aminophenyl)-N'-[(2E)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]-N'-sulfanylheptanediamide (PubChem CID 155663157) has the molecular formula C21H26N6O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-N'-[(2E)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]-N'-sulfanylheptanediamide.
| Compound Name | N-(2-aminophenyl)-N'-[(2E)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]-N'-sulfanylheptanediamide |
|---|---|
| PubChem CID | 155663157 |
| Molecular Formula | C21H26N6O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-(2-aminophenyl)-N'-[(2E)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]-N'-sulfanylheptanediamide |
| SMILES | C/C(=N\NN(S)C(=O)CCCCCC(=O)Nc1ccccc1N)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N6O4S/c1-15(16-8-7-9-17(14-16)27(30)31)24-25-26(32)21(29)13-4-2-3-12-20(28)23-19-11-6-5-10-18(19)22/h5-11,14,25,32H,2-4,12-13,22H2,1H3,(H,23,28)/b24-15+ |
| InChIKey | JNGIQMZHZLXOBT-BUVRLJJBSA-N |
| XLogP | 3.67 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|