C15H21BrN4O3S — CID 155663169
N'-[(2E)-2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-N-hydroxy-N'-sulfanylheptanediamide (PubChem CID 155663169) has the molecular formula C15H21BrN4O3S and a molecular weight of 417.33 g/mol. Its IUPAC name is N'-[(2E)-2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-N-hydroxy-N'-sulfanylheptanediamide.
| Compound Name | N'-[(2E)-2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-N-hydroxy-N'-sulfanylheptanediamide |
|---|---|
| PubChem CID | 155663169 |
| Molecular Formula | C15H21BrN4O3S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N'-[(2E)-2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-N-hydroxy-N'-sulfanylheptanediamide |
| SMILES | C/C(=N\NN(S)C(=O)CCCCCC(=O)NO)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H21BrN4O3S/c1-11(12-6-5-7-13(16)10-12)17-19-20(24)15(22)9-4-2-3-8-14(21)18-23/h5-7,10,19,23-24H,2-4,8-9H2,1H3,(H,18,21)/b17-11+ |
| InChIKey | URHCEQQKFMGTIJ-GZTJUZNOSA-N |
| XLogP | 2.81 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|