C20H15F2N7 — CID 155664702
1-[1-[6-fluoro-1-(3-fluorophenyl)indazol-3-yl]ethyl]-7H-purin-6-imine (PubChem CID 155664702) has the molecular formula C20H15F2N7 and a molecular weight of 391.39 g/mol. Its IUPAC name is 1-[1-[6-fluoro-1-(3-fluorophenyl)indazol-3-yl]ethyl]-7H-purin-6-imine.
| Compound Name | 1-[1-[6-fluoro-1-(3-fluorophenyl)indazol-3-yl]ethyl]-7H-purin-6-imine |
|---|---|
| PubChem CID | 155664702 |
| Molecular Formula | C20H15F2N7 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[1-[6-fluoro-1-(3-fluorophenyl)indazol-3-yl]ethyl]-7H-purin-6-imine |
| SMILES | [H]/N=c1\c2[nH]cnc2ncn1C(C)c1nn(-c2cccc(F)c2)c2cc(F)ccc12 |
| InChI | InChI=1S/C20H15F2N7/c1-11(28-10-26-20-18(19(28)23)24-9-25-20)17-15-6-5-13(22)8-16(15)29(27-17)14-4-2-3-12(21)7-14/h2-11,23H,1H3,(H,24,25)/b23-19+ |
| InChIKey | UGYMYLQGZRSHRT-FCDQGJHFSA-N |
| XLogP | 3.47 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |