C21H15Cl2FN6 — CID 54767317
N-[1-[3,4-dichloro-1-(3-fluorophenyl)indol-2-yl]ethyl]-7H-purin-6-amine (PubChem CID 54767317) has the molecular formula C21H15Cl2FN6 and a molecular weight of 441.30 g/mol. Its IUPAC name is N-[1-[3,4-dichloro-1-(3-fluorophenyl)indol-2-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[3,4-dichloro-1-(3-fluorophenyl)indol-2-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 54767317 |
| Molecular Formula | C21H15Cl2FN6 |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[1-[3,4-dichloro-1-(3-fluorophenyl)indol-2-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1c(Cl)c2c(Cl)cccc2n1-c1cccc(F)c1 |
| InChI | InChI=1S/C21H15Cl2FN6/c1-11(29-21-18-20(26-9-25-18)27-10-28-21)19-17(23)16-14(22)6-3-7-15(16)30(19)13-5-2-4-12(24)8-13/h2-11H,1H3,(H2,25,26,27,28,29) |
| InChIKey | HENXOEGHWGBOFH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |