C19H19NO2 — CID 155666059
(2-ethyl-4-methyl-4-phenyl-5H-1,3-oxazol-5-yl)-phenylmethanone (PubChem CID 155666059) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2-ethyl-4-methyl-4-phenyl-5H-1,3-oxazol-5-yl)-phenylmethanone.
| Compound Name | (2-ethyl-4-methyl-4-phenyl-5H-1,3-oxazol-5-yl)-phenylmethanone |
|---|---|
| PubChem CID | 155666059 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2-ethyl-4-methyl-4-phenyl-5H-1,3-oxazol-5-yl)-phenylmethanone |
| SMILES | CCC1=NC(C)(c2ccccc2)C(C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H19NO2/c1-3-16-20-19(2,15-12-8-5-9-13-15)18(22-16)17(21)14-10-6-4-7-11-14/h4-13,18H,3H2,1-2H3 |
| InChIKey | LDAWTORJEBLRMV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |