C25H24O4 — CID 155666359
12,14-dioxatetracyclo[8.7.0.02,6.011,15]heptadeca-1,3,5,7,9,11(15),16-heptaen-7-yl (2E,4E)-deca-2,4-dienoate (PubChem CID 155666359) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is 12,14-dioxatetracyclo[8.7.0.02,6.011,15]heptadeca-1,3,5,7,9,11(15),16-heptaen-7-yl (2E,4E)-deca-2,4-dienoate.
| Compound Name | 12,14-dioxatetracyclo[8.7.0.02,6.011,15]heptadeca-1,3,5,7,9,11(15),16-heptaen-7-yl (2E,4E)-deca-2,4-dienoate |
|---|---|
| PubChem CID | 155666359 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 12,14-dioxatetracyclo[8.7.0.02,6.011,15]heptadeca-1,3,5,7,9,11(15),16-heptaen-7-yl (2E,4E)-deca-2,4-dienoate |
| SMILES | CCCCC/C=C/C=C/C(=O)Oc1ccc2c3c(ccc2c2cccc1-2)OCO3 |
| InChI | InChI=1S/C25H24O4/c1-2-3-4-5-6-7-8-12-24(26)29-22-15-14-21-19(18-10-9-11-20(18)22)13-16-23-25(21)28-17-27-23/h6-16H,2-5,17H2,1H3/b7-6+,12-8+ |
| InChIKey | KGXJOBWBZOIFKL-ZYUHXDNHSA-N |
| XLogP | 6.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|