C21H24N4O2Sn — CID 155667779
tert-butyl-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-5-yl]tin (PubChem CID 155667779) has the molecular formula C21H24N4O2Sn and a molecular weight of 483.16 g/mol. Its IUPAC name is tert-butyl-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-5-yl]tin.
| Compound Name | tert-butyl-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-5-yl]tin |
|---|---|
| PubChem CID | 155667779 |
| Molecular Formula | C21H24N4O2Sn |
| Molecular Weight | 483.16 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | tert-butyl-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-5-yl]tin |
| SMILES | CC(C)(C)[Sn]c1cccc2nc(C(=O)NCC(=O)N3CCC[C@H]3C#N)ccc12 |
| InChI | InChI=1S/C17H15N4O2.C4H9.Sn/c18-10-13-5-3-9-21(13)16(22)11-19-17(23)15-8-7-12-4-1-2-6-14(12)20-15;1-4(2)3;/h1-2,6-8,13H,3,5,9,11H2,(H,19,23);1-3H3;/t13-;;/m0../s1 |
| InChIKey | ANKRJYPEROYGSS-GXKRWWSZSA-N |
| XLogP | 2.03 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |