C18H24O6 — CID 155669457
[1-(2-methylpropoxy)-2-prop-2-enoyloxy-1-(2H-pyran-2-yl)ethyl] 2-methylprop-2-enoate (PubChem CID 155669457) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [1-(2-methylpropoxy)-2-prop-2-enoyloxy-1-(2H-pyran-2-yl)ethyl] 2-methylprop-2-enoate.
| Compound Name | [1-(2-methylpropoxy)-2-prop-2-enoyloxy-1-(2H-pyran-2-yl)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155669457 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [1-(2-methylpropoxy)-2-prop-2-enoyloxy-1-(2H-pyran-2-yl)ethyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC(OCC(C)C)(OC(=O)C(=C)C)C1C=CC=CO1 |
| InChI | InChI=1S/C18H24O6/c1-6-16(19)22-12-18(23-11-13(2)3,24-17(20)14(4)5)15-9-7-8-10-21-15/h6-10,13,15H,1,4,11-12H2,2-3,5H3 |
| InChIKey | DEHGNLQQESYHTI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|