C10H19NO2 — CID 155671105
(7S,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-ol (PubChem CID 155671105) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (7S,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-ol.
| Compound Name | (7S,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-ol |
|---|---|
| PubChem CID | 155671105 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (7S,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-ol |
| SMILES | CC[C@@H]1C(O)CN2[C@@H]1COC2(C)C |
| InChI | InChI=1S/C10H19NO2/c1-4-7-8-6-13-10(2,3)11(8)5-9(7)12/h7-9,12H,4-6H2,1-3H3/t7-,8+,9?/m0/s1 |
| InChIKey | LSKIRMQMPCGDGT-ZQTLJVIJSA-N |
| XLogP | 0.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |