C10H19NO3 — CID 141470037
1-[(7R,7aS)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]ethane-1,2-diol (PubChem CID 141470037) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-[(7R,7aS)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]ethane-1,2-diol.
| Compound Name | 1-[(7R,7aS)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 141470037 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 1-[(7R,7aS)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]ethane-1,2-diol |
| SMILES | CC1(C)OC[C@@H]2[C@H](C(O)CO)CCN21 |
| InChI | InChI=1S/C10H19NO3/c1-10(2)11-4-3-7(9(13)5-12)8(11)6-14-10/h7-9,12-13H,3-6H2,1-2H3/t7-,8-,9?/m1/s1 |
| InChIKey | PCNIDUXNALBWEB-ZAZKALAHSA-N |
| XLogP | -0.20 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |