C8H15NO2 — CID 67565976
[(3aS,4S,6aR)-5-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-4-yl]methanol (PubChem CID 67565976) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is [(3aS,4S,6aR)-5-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-4-yl]methanol.
| Compound Name | [(3aS,4S,6aR)-5-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-4-yl]methanol |
|---|---|
| PubChem CID | 67565976 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | [(3aS,4S,6aR)-5-methyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-4-yl]methanol |
| SMILES | CN1C[C@@H]2COC[C@@H]2[C@H]1CO |
| InChI | InChI=1S/C8H15NO2/c1-9-2-6-4-11-5-7(6)8(9)3-10/h6-8,10H,2-5H2,1H3/t6-,7+,8-/m1/s1 |
| InChIKey | AEHMVLOLVXCCIT-GJMOJQLCSA-N |
| XLogP | -0.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |