C15H20O — CID 155674731
1-[(Z)-hex-3-enoxy]prop-1-en-2-ylbenzene (PubChem CID 155674731) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-[(Z)-hex-3-enoxy]prop-1-en-2-ylbenzene.
| Compound Name | 1-[(Z)-hex-3-enoxy]prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 155674731 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-[(Z)-hex-3-enoxy]prop-1-en-2-ylbenzene |
| SMILES | CC/C=C\CCOC=C(C)c1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-3-4-5-9-12-16-13-14(2)15-10-7-6-8-11-15/h4-8,10-11,13H,3,9,12H2,1-2H3/b5-4-,14-13? |
| InChIKey | JMZUPIRPVXKCNH-JFOHSBFPSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|