C14H18O2S — CID 176603220
2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiirane 1-oxide (PubChem CID 176603220) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiirane 1-oxide.
| Compound Name | 2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiirane 1-oxide |
|---|---|
| PubChem CID | 176603220 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiirane 1-oxide |
| SMILES | C/C(=C/OCCCC1CS1=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-12(13-6-3-2-4-7-13)10-16-9-5-8-14-11-17(14)15/h2-4,6-7,10,14H,5,8-9,11H2,1H3/b12-10- |
| InChIKey | MSCOFMNBFUFYOK-BENRWUELSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|