C19H28O2S — CID 176603526
2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiocane 1-oxide (PubChem CID 176603526) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiocane 1-oxide.
| Compound Name | 2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiocane 1-oxide |
|---|---|
| PubChem CID | 176603526 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[3-[(Z)-2-phenylprop-1-enoxy]propyl]thiocane 1-oxide |
| SMILES | C/C(=C/OCCCC1CCCCCCS1=O)c1ccccc1 |
| InChI | InChI=1S/C19H28O2S/c1-17(18-10-5-4-6-11-18)16-21-14-9-13-19-12-7-2-3-8-15-22(19)20/h4-6,10-11,16,19H,2-3,7-9,12-15H2,1H3/b17-16- |
| InChIKey | CKMXBUWHFYDATC-MSUUIHNZSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|