C20H26OS — CID 176603843
4-[[(Z)-2-phenylprop-1-enoxy]methyl]-11-thiatricyclo[6.2.1.02,7]undecane (PubChem CID 176603843) has the molecular formula C20H26OS and a molecular weight of 314.49 g/mol. Its IUPAC name is 4-[[(Z)-2-phenylprop-1-enoxy]methyl]-11-thiatricyclo[6.2.1.02,7]undecane.
| Compound Name | 4-[[(Z)-2-phenylprop-1-enoxy]methyl]-11-thiatricyclo[6.2.1.02,7]undecane |
|---|---|
| PubChem CID | 176603843 |
| Molecular Formula | C20H26OS |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-[[(Z)-2-phenylprop-1-enoxy]methyl]-11-thiatricyclo[6.2.1.02,7]undecane |
| SMILES | C/C(=C/OCC1CCC2C3CCC(S3)C2C1)c1ccccc1 |
| InChI | InChI=1S/C20H26OS/c1-14(16-5-3-2-4-6-16)12-21-13-15-7-8-17-18(11-15)20-10-9-19(17)22-20/h2-6,12,15,17-20H,7-11,13H2,1H3/b14-12- |
| InChIKey | OBZGVHXSTDJQRL-OWBHPGMISA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|