C22H19N7O5S — CID 155675713
ethyl 4-methyl-5-(4-nitrophenyl)-2-[(6-pyrazol-1-ylpyridazin-3-yl)carbamoylamino]thiophene-3-carboxylate (PubChem CID 155675713) has the molecular formula C22H19N7O5S and a molecular weight of 493.51 g/mol. Its IUPAC name is ethyl 4-methyl-5-(4-nitrophenyl)-2-[(6-pyrazol-1-ylpyridazin-3-yl)carbamoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-methyl-5-(4-nitrophenyl)-2-[(6-pyrazol-1-ylpyridazin-3-yl)carbamoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 155675713 |
| Molecular Formula | C22H19N7O5S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | ethyl 4-methyl-5-(4-nitrophenyl)-2-[(6-pyrazol-1-ylpyridazin-3-yl)carbamoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Nc2ccc(-n3cccn3)nn2)sc(-c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C22H19N7O5S/c1-3-34-21(30)18-13(2)19(14-5-7-15(8-6-14)29(32)33)35-20(18)25-22(31)24-16-9-10-17(27-26-16)28-12-4-11-23-28/h4-12H,3H2,1-2H3,(H2,24,25,26,31) |
| InChIKey | BCHIMGSWWZUYSU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|