C11H16ClNO2Pd — CID 155678161
chloropalladium(1+);1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine (PubChem CID 155678161) has the molecular formula C11H16ClNO2Pd and a molecular weight of 336.13 g/mol. Its IUPAC name is chloropalladium(1+);1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine.
| Compound Name | chloropalladium(1+);1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 155678161 |
| Molecular Formula | C11H16ClNO2Pd |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | chloropalladium(1+);1-(2,4-dimethoxybenzene-6-id-1-yl)-N,N-dimethylmethanamine |
| SMILES | COc1c[c-]c(CN(C)C)c(OC)c1.Cl[Pd+] |
| InChI | InChI=1S/C11H16NO2.ClH.Pd/c1-12(2)8-9-5-6-10(13-3)7-11(9)14-4;;/h6-7H,8H2,1-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | AGXFSBHCAVAZNO-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|